C13H9N3O3S — CID 66380263
2-[[(3-cyanobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66380263) has the molecular formula C13H9N3O3S and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-[[(3-cyanobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[(3-cyanobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66380263 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-[[(3-cyanobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | N#Cc1cccc(C(=O)NCc2nc(C(=O)O)cs2)c1 |
| InChI | InChI=1S/C13H9N3O3S/c14-5-8-2-1-3-9(4-8)12(17)15-6-11-16-10(7-20-11)13(18)19/h1-4,7H,6H2,(H,15,17)(H,18,19) |
| InChIKey | MLLADFSSZBSRNX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |