C12H9N2O3S- — CID 7140214
2-(benzamidomethyl)-1,3-thiazole-4-carboxylate (PubChem CID 7140214) has the molecular formula C12H9N2O3S- and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-(benzamidomethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | 2-(benzamidomethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 7140214 |
| Molecular Formula | C12H9N2O3S- |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 2-(benzamidomethyl)-1,3-thiazole-4-carboxylate |
| SMILES | O=C(NCc1nc(C(=O)[O-])cs1)c1ccccc1 |
| InChI | InChI=1S/C12H10N2O3S/c15-11(8-4-2-1-3-5-8)13-6-10-14-9(7-18-10)12(16)17/h1-5,7H,6H2,(H,13,15)(H,16,17)/p-1 |
| InChIKey | SBSNAWQRPBIPFE-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |