C16H11NO2S — CID 79567342
4-(4-phenylphenyl)-1,3-thiazole-2-carboxylic acid (PubChem CID 79567342) has the molecular formula C16H11NO2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-(4-phenylphenyl)-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 79567342 |
| Molecular Formula | C16H11NO2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 4-(4-phenylphenyl)-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C16H11NO2S/c18-16(19)15-17-14(10-20-15)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-10H,(H,18,19) |
| InChIKey | ALXGZNOPFIWJMH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |