C12H12ClFN2S — CID 62942920
4-(3-chloro-4-fluorophenyl)-N-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 62942920) has the molecular formula C12H12ClFN2S and a molecular weight of 270.76 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)-N-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | 4-(3-chloro-4-fluorophenyl)-N-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62942920 |
| Molecular Formula | C12H12ClFN2S |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)-N-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | CC(C)Nc1nc(-c2ccc(F)c(Cl)c2)cs1 |
| InChI | InChI=1S/C12H12ClFN2S/c1-7(2)15-12-16-11(6-17-12)8-3-4-10(14)9(13)5-8/h3-7H,1-2H3,(H,15,16) |
| InChIKey | UHQYCUNXQXPCNG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |