C14H16ClFN2S — CID 61337081
3-[4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl]pentan-3-amine (PubChem CID 61337081) has the molecular formula C14H16ClFN2S and a molecular weight of 298.81 g/mol. Its IUPAC name is 3-[4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl]pentan-3-amine.
| Compound Name | 3-[4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl]pentan-3-amine |
|---|---|
| PubChem CID | 61337081 |
| Molecular Formula | C14H16ClFN2S |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 3-[4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl]pentan-3-amine |
| SMILES | CCC(N)(CC)c1nc(-c2ccc(F)c(Cl)c2)cs1 |
| InChI | InChI=1S/C14H16ClFN2S/c1-3-14(17,4-2)13-18-12(8-19-13)9-5-6-11(16)10(15)7-9/h5-8H,3-4,17H2,1-2H3 |
| InChIKey | ZZMSCCHJUOVBJT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |