C13H15ClN2S — CID 61337270
2-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]butan-2-amine (PubChem CID 61337270) has the molecular formula C13H15ClN2S and a molecular weight of 266.80 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]butan-2-amine.
| Compound Name | 2-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 61337270 |
| Molecular Formula | C13H15ClN2S |
| Molecular Weight | 266.80 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]butan-2-amine |
| SMILES | CCC(C)(N)c1nc(-c2cccc(Cl)c2)cs1 |
| InChI | InChI=1S/C13H15ClN2S/c1-3-13(2,15)12-16-11(8-17-12)9-5-4-6-10(14)7-9/h4-8H,3,15H2,1-2H3 |
| InChIKey | PSEZAPWDGDSVDY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |