C17H18N2S — CID 61337854
2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)butan-2-amine (PubChem CID 61337854) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)butan-2-amine.
| Compound Name | 2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 61337854 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)butan-2-amine |
| SMILES | CCC(C)(N)c1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C17H18N2S/c1-3-17(2,18)16-19-15(11-20-16)14-10-6-8-12-7-4-5-9-13(12)14/h4-11H,3,18H2,1-2H3 |
| InChIKey | SZTYSHQDYYLTGM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |