C15H10N2S — CID 24708724
2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)acetonitrile (PubChem CID 24708724) has the molecular formula C15H10N2S and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)acetonitrile.
| Compound Name | 2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 24708724 |
| Molecular Formula | C15H10N2S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)acetonitrile |
| SMILES | N#CCc1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C15H10N2S/c16-9-8-15-17-14(10-18-15)13-7-3-5-11-4-1-2-6-12(11)13/h1-7,10H,8H2 |
| InChIKey | UZYWYSSCIZGPQL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |