C15H10NNaO2S — CID 75414423
sodium 2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)acetate (PubChem CID 75414423) has the molecular formula C15H10NNaO2S and a molecular weight of 291.31 g/mol. Its IUPAC name is sodium 2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)acetate.
| Compound Name | sodium 2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)acetate |
|---|---|
| PubChem CID | 75414423 |
| Molecular Formula | C15H10NNaO2S |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | sodium 2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)acetate |
| SMILES | O=C([O-])Cc1nc(-c2cccc3ccccc23)cs1.[Na+] |
| InChI | InChI=1S/C15H11NO2S.Na/c17-15(18)8-14-16-13(9-19-14)12-7-3-5-10-4-1-2-6-11(10)12;/h1-7,9H,8H2,(H,17,18);/q;+1/p-1 |
| InChIKey | XMTUDYXGFRTRGZ-UHFFFAOYSA-M |
| XLogP | -0.74 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |