C33H41NO4S2 — CID 90776522
dimethyl 4-hexylthiophene-2,3-dicarboxylate;2-hexyl-4-naphthalen-1-yl-1,3-thiazole (PubChem CID 90776522) has the molecular formula C33H41NO4S2 and a molecular weight of 579.83 g/mol. Its IUPAC name is dimethyl 4-hexylthiophene-2,3-dicarboxylate;2-hexyl-4-naphthalen-1-yl-1,3-thiazole.
| Compound Name | dimethyl 4-hexylthiophene-2,3-dicarboxylate;2-hexyl-4-naphthalen-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 90776522 |
| Molecular Formula | C33H41NO4S2 |
| Molecular Weight | 579.83 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | dimethyl 4-hexylthiophene-2,3-dicarboxylate;2-hexyl-4-naphthalen-1-yl-1,3-thiazole |
| SMILES | CCCCCCc1csc(C(=O)OC)c1C(=O)OC.CCCCCCc1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C19H21NS.C14H20O4S/c1-2-3-4-5-13-19-20-18(14-21-19)17-12-8-10-15-9-6-7-11-16(15)17;1-4-5-6-7-8-10-9-19-12(14(16)18-3)11(10)13(15)17-2/h6-12,14H,2-5,13H2,1H3;9H,4-8H2,1-3H3 |
| InChIKey | NBVLMDJFPVWDGJ-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.83 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|