C22H15NOS — CID 67031419
1-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-one (PubChem CID 67031419) has the molecular formula C22H15NOS and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-one.
| Compound Name | 1-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 67031419 |
| Molecular Formula | C22H15NOS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 1-(4-naphthalen-1-yl-1,3-thiazol-2-yl)-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)c1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C22H15NOS/c24-21(14-13-16-7-2-1-3-8-16)22-23-20(15-25-22)19-12-6-10-17-9-4-5-11-18(17)19/h1-15H |
| InChIKey | SKILHUBKVCDHIU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|