C24H17N3OS — CID 3728220
3-(3-acetylanilino)-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 3728220) has the molecular formula C24H17N3OS and a molecular weight of 395.49 g/mol. Its IUPAC name is 3-(3-acetylanilino)-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(3-acetylanilino)-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3728220 |
| Molecular Formula | C24H17N3OS |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 3-(3-acetylanilino)-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | CC(=O)c1cccc(NC=C(C#N)c2nc(-c3cccc4ccccc34)cs2)c1 |
| InChI | InChI=1S/C24H17N3OS/c1-16(28)18-8-4-9-20(12-18)26-14-19(13-25)24-27-23(15-29-24)22-11-5-7-17-6-2-3-10-21(17)22/h2-12,14-15,26H,1H3 |
| InChIKey | UUGOQZOQGWHCCL-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|