C27H17N3O4S — CID 45029909
methyl 4-[[(E)-2-cyano-2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate (PubChem CID 45029909) has the molecular formula C27H17N3O4S and a molecular weight of 479.52 g/mol. Its IUPAC name is methyl 4-[[(E)-2-cyano-2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate.
| Compound Name | methyl 4-[[(E)-2-cyano-2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate |
|---|---|
| PubChem CID | 45029909 |
| Molecular Formula | C27H17N3O4S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | methyl 4-[[(E)-2-cyano-2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N/C=C(\C#N)c2nc(-c3cc4c(ccc5ccccc54)oc3=O)cs2)cc1 |
| InChI | InChI=1S/C27H17N3O4S/c1-33-26(31)17-6-9-19(10-7-17)29-14-18(13-28)25-30-23(15-35-25)22-12-21-20-5-3-2-4-16(20)8-11-24(21)34-27(22)32/h2-12,14-15,29H,1H3/b18-14+ |
| InChIKey | OJXRUNKEJZGBRC-NBVRZTHBSA-N |
| XLogP | 5.83 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|