C25H18ClN3O4S — CID 27532530
propan-2-yl 4-[[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]benzoate (PubChem CID 27532530) has the molecular formula C25H18ClN3O4S and a molecular weight of 491.96 g/mol. Its IUPAC name is propan-2-yl 4-[[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]benzoate |
|---|---|
| PubChem CID | 27532530 |
| Molecular Formula | C25H18ClN3O4S |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | propan-2-yl 4-[[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(N/C=C(\C#N)c2nc(-c3cc4cc(Cl)ccc4oc3=O)cs2)cc1 |
| InChI | InChI=1S/C25H18ClN3O4S/c1-14(2)32-24(30)15-3-6-19(7-4-15)28-12-17(11-27)23-29-21(13-34-23)20-10-16-9-18(26)5-8-22(16)33-25(20)31/h3-10,12-14,28H,1-2H3/b17-12+ |
| InChIKey | RLFIDXQVQXVWTA-SFQUDFHCSA-N |
| XLogP | 6.11 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|