C23H16BrN3O3S — CID 4293025
2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(4-ethoxyanilino)prop-2-enenitrile (PubChem CID 4293025) has the molecular formula C23H16BrN3O3S and a molecular weight of 494.37 g/mol. Its IUPAC name is 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(4-ethoxyanilino)prop-2-enenitrile.
| Compound Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(4-ethoxyanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 4293025 |
| Molecular Formula | C23H16BrN3O3S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(4-ethoxyanilino)prop-2-enenitrile |
| SMILES | CCOc1ccc(NC=C(C#N)c2nc(-c3cc4cc(Br)ccc4oc3=O)cs2)cc1 |
| InChI | InChI=1S/C23H16BrN3O3S/c1-2-29-18-6-4-17(5-7-18)26-12-15(11-25)22-27-20(13-31-22)19-10-14-9-16(24)3-8-21(14)30-23(19)28/h3-10,12-13,26H,2H2,1H3 |
| InChIKey | DWMHKMSRGZDJCB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|