C24H18BrN3O5S — CID 1383129
(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyanilino)prop-2-enenitrile (PubChem CID 1383129) has the molecular formula C24H18BrN3O5S and a molecular weight of 540.40 g/mol. Its IUPAC name is (E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyanilino)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 1383129 |
| Molecular Formula | C24H18BrN3O5S |
| Molecular Weight | 540.40 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | (E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyanilino)prop-2-enenitrile |
| SMILES | COc1cc(N/C=C(\C#N)c2nc(-c3cc4cc(Br)ccc4oc3=O)cs2)cc(OC)c1OC |
| InChI | InChI=1S/C24H18BrN3O5S/c1-30-20-8-16(9-21(31-2)22(20)32-3)27-11-14(10-26)23-28-18(12-34-23)17-7-13-6-15(25)4-5-19(13)33-24(17)29/h4-9,11-12,27H,1-3H3/b14-11+ |
| InChIKey | ZWMMLLSUGJFKRC-SDNWHVSQSA-N |
| XLogP | 5.68 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.40 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|