C24H18N2O5S — CID 3833015
2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 3833015) has the molecular formula C24H18N2O5S and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3833015 |
| Molecular Formula | C24H18N2O5S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2nc(-c3cc4ccccc4oc3=O)cs2)cc(OC)c1OC |
| InChI | InChI=1S/C24H18N2O5S/c1-28-20-9-14(10-21(29-2)22(20)30-3)8-16(12-25)23-26-18(13-32-23)17-11-15-6-4-5-7-19(15)31-24(17)27/h4-11,13H,1-3H3 |
| InChIKey | GCKZPHLSLJIKDX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|