C22H13BrN2O4S — CID 3721451
3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3721451) has the molecular formula C22H13BrN2O4S and a molecular weight of 481.33 g/mol. Its IUPAC name is 3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3721451 |
| Molecular Formula | C22H13BrN2O4S |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | 3-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2nc(-c3cc4ccccc4oc3=O)cs2)cc(Br)c1O |
| InChI | InChI=1S/C22H13BrN2O4S/c1-28-19-8-12(7-16(23)20(19)26)6-14(10-24)21-25-17(11-30-21)15-9-13-4-2-3-5-18(13)29-22(15)27/h2-9,11,26H,1H3 |
| InChIKey | PSQDOIOLKBZKNA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|