C29H19BrN2O4S — CID 4917218
2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile (PubChem CID 4917218) has the molecular formula C29H19BrN2O4S and a molecular weight of 571.45 g/mol. Its IUPAC name is 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4917218 |
| Molecular Formula | C29H19BrN2O4S |
| Molecular Weight | 571.45 g/mol |
| Exact Mass | 570.02 |
| IUPAC Name | 2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2nc(-c3cc4cc(Br)ccc4oc3=O)cs2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H19BrN2O4S/c1-34-27-12-19(7-9-26(27)35-16-18-5-3-2-4-6-18)11-21(15-31)28-32-24(17-37-28)23-14-20-13-22(30)8-10-25(20)36-29(23)33/h2-14,17H,16H2,1H3 |
| InChIKey | CKWIFVDVJKCQGD-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.45 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|