C30H20BrN3O5S — CID 6197342
2-[4-[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenoxy]-N-phenylacetamide (PubChem CID 6197342) has the molecular formula C30H20BrN3O5S and a molecular weight of 614.48 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 6197342 |
| Molecular Formula | C30H20BrN3O5S |
| Molecular Weight | 614.48 g/mol |
| Exact Mass | 613.03 |
| IUPAC Name | 2-[4-[(E)-2-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenoxy]-N-phenylacetamide |
| SMILES | COc1cc(/C=C(\C#N)c2nc(-c3cc4cc(Br)ccc4oc3=O)cs2)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C30H20BrN3O5S/c1-37-27-12-18(7-9-26(27)38-16-28(35)33-22-5-3-2-4-6-22)11-20(15-32)29-34-24(17-40-29)23-14-19-13-21(31)8-10-25(19)39-30(23)36/h2-14,17H,16H2,1H3,(H,33,35)/b20-11+ |
| InChIKey | MBEVERHMASYBKF-RGVLZGJSSA-N |
| XLogP | 6.77 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.48 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|