C29H18ClN3O4S — CID 6197289
2-[2-[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]phenoxy]-N-phenylacetamide (PubChem CID 6197289) has the molecular formula C29H18ClN3O4S and a molecular weight of 540.00 g/mol. Its IUPAC name is 2-[2-[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 6197289 |
| Molecular Formula | C29H18ClN3O4S |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 2-[2-[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]phenoxy]-N-phenylacetamide |
| SMILES | N#C/C(=C\c1ccccc1OCC(=O)Nc1ccccc1)c1nc(-c2cc3cc(Cl)ccc3oc2=O)cs1 |
| InChI | InChI=1S/C29H18ClN3O4S/c30-21-10-11-26-19(13-21)14-23(29(35)37-26)24-17-38-28(33-24)20(15-31)12-18-6-4-5-9-25(18)36-16-27(34)32-22-7-2-1-3-8-22/h1-14,17H,16H2,(H,32,34)/b20-12+ |
| InChIKey | RTXCGYJDVPJNLJ-UDWIEESQSA-N |
| XLogP | 6.65 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|