C25H13ClN2O3S — CID 6085188
(E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 6085188) has the molecular formula C25H13ClN2O3S and a molecular weight of 456.91 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6085188 |
| Molecular Formula | C25H13ClN2O3S |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(Cl)cc2)o1)c1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C25H13ClN2O3S/c26-18-7-5-15(6-8-18)23-10-9-19(30-23)11-17(13-27)24-28-21(14-32-24)20-12-16-3-1-2-4-22(16)31-25(20)29/h1-12,14H/b17-11+ |
| InChIKey | FJRBOLPJUHQFHB-GZTJUZNOSA-N |
| XLogP | 6.89 |
| TPSA | 80.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|