C22H11Cl3N2OS — CID 6029110
(E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 6029110) has the molecular formula C22H11Cl3N2OS and a molecular weight of 457.77 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6029110 |
| Molecular Formula | C22H11Cl3N2OS |
| Molecular Weight | 457.77 g/mol |
| Exact Mass | 455.97 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(Cl)cc2)o1)c1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C22H11Cl3N2OS/c23-15-3-1-13(2-4-15)21-8-6-17(28-21)9-14(11-26)22-27-20(12-29-22)18-7-5-16(24)10-19(18)25/h1-10,12H/b14-9+ |
| InChIKey | HQXTYAGIXNMQHD-NTEUORMPSA-N |
| XLogP | 8.09 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.77 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|