C26H15BrN2OS — CID 6199422
(E)-3-[5-(4-bromophenyl)furan-2-yl]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 6199422) has the molecular formula C26H15BrN2OS and a molecular weight of 483.39 g/mol. Its IUPAC name is (E)-3-[5-(4-bromophenyl)furan-2-yl]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6199422 |
| Molecular Formula | C26H15BrN2OS |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(Br)cc2)o1)c1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C26H15BrN2OS/c27-20-10-8-18(9-11-20)25-13-12-21(30-25)14-19(15-28)26-29-24(16-31-26)23-7-3-5-17-4-1-2-6-22(17)23/h1-14,16H/b19-14+ |
| InChIKey | FPQLFJFRMNLJMG-XMHGGMMESA-N |
| XLogP | 8.05 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|