C26H14Cl2N2OS — CID 6199264
(E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 6199264) has the molecular formula C26H14Cl2N2OS and a molecular weight of 473.38 g/mol. Its IUPAC name is (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6199264 |
| Molecular Formula | C26H14Cl2N2OS |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | (E)-3-[5-(3,4-dichlorophenyl)furan-2-yl]-2-(4-naphthalen-1-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(Cl)c(Cl)c2)o1)c1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C26H14Cl2N2OS/c27-22-10-8-17(13-23(22)28)25-11-9-19(31-25)12-18(14-29)26-30-24(15-32-26)21-7-3-5-16-4-1-2-6-20(16)21/h1-13,15H/b18-12+ |
| InChIKey | GFTFEZSADWANOG-LDADJPATSA-N |
| XLogP | 8.59 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|