C27H14ClF3N2OS — CID 18864022
(E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 18864022) has the molecular formula C27H14ClF3N2OS and a molecular weight of 506.94 g/mol. Its IUPAC name is (E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18864022 |
| Molecular Formula | C27H14ClF3N2OS |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | (E)-3-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-2-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1)c1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C27H14ClF3N2OS/c28-23-9-7-20(27(29,30)31)13-22(23)25-10-8-21(34-25)12-19(14-32)26-33-24(15-35-26)18-6-5-16-3-1-2-4-17(16)11-18/h1-13,15H/b19-12+ |
| InChIKey | LYMNJGLCYRNIAL-XDHOZWIPSA-N |
| XLogP | 8.96 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|