C22H12Br2N2OS — CID 4736358
3-[5-(4-bromophenyl)furan-2-yl]-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 4736358) has the molecular formula C22H12Br2N2OS and a molecular weight of 512.23 g/mol. Its IUPAC name is 3-[5-(4-bromophenyl)furan-2-yl]-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[5-(4-bromophenyl)furan-2-yl]-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4736358 |
| Molecular Formula | C22H12Br2N2OS |
| Molecular Weight | 512.23 g/mol |
| Exact Mass | 509.90 |
| IUPAC Name | 3-[5-(4-bromophenyl)furan-2-yl]-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccc(Br)cc2)o1)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C22H12Br2N2OS/c23-17-5-1-14(2-6-17)20-13-28-22(26-20)16(12-25)11-19-9-10-21(27-19)15-3-7-18(24)8-4-15/h1-11,13H |
| InChIKey | QFJPDEUFGKCPMD-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.23 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|