C27H17ClN4O5S2 — CID 6197369
2-[4-[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenoxy]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 6197369) has the molecular formula C27H17ClN4O5S2 and a molecular weight of 577.04 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenoxy]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[4-[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenoxy]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 6197369 |
| Molecular Formula | C27H17ClN4O5S2 |
| Molecular Weight | 577.04 g/mol |
| Exact Mass | 576.03 |
| IUPAC Name | 2-[4-[(E)-2-[4-(6-chloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenoxy]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | COc1cc(/C=C(\C#N)c2nc(-c3cc4cc(Cl)ccc4oc3=O)cs2)ccc1OCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C27H17ClN4O5S2/c1-35-23-9-15(2-4-22(23)36-13-24(33)32-27-30-6-7-38-27)8-17(12-29)25-31-20(14-39-25)19-11-16-10-18(28)3-5-21(16)37-26(19)34/h2-11,14H,13H2,1H3,(H,30,32,33)/b17-8+ |
| InChIKey | CWQDVLWRIKQMLU-CAOOACKPSA-N |
| XLogP | 6.12 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.04 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|