C20H14Cl2N2O2S — CID 3123539
2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 3123539) has the molecular formula C20H14Cl2N2O2S and a molecular weight of 417.32 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3123539 |
| Molecular Formula | C20H14Cl2N2O2S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(3,4-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(C=C(C#N)c2nc(-c3ccc(Cl)cc3Cl)cs2)cc1OC |
| InChI | InChI=1S/C20H14Cl2N2O2S/c1-25-18-6-3-12(8-19(18)26-2)7-13(10-23)20-24-17(11-27-20)15-5-4-14(21)9-16(15)22/h3-9,11H,1-2H3 |
| InChIKey | RZVMQKJGZIXPRW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|