C18H8Br2Cl2N2OS — CID 135437586
(Z)-3-(3,5-dibromo-4-hydroxyphenyl)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 135437586) has the molecular formula C18H8Br2Cl2N2OS and a molecular weight of 531.06 g/mol. Its IUPAC name is (Z)-3-(3,5-dibromo-4-hydroxyphenyl)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dibromo-4-hydroxyphenyl)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 135437586 |
| Molecular Formula | C18H8Br2Cl2N2OS |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 527.81 |
| IUPAC Name | (Z)-3-(3,5-dibromo-4-hydroxyphenyl)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(Br)c(O)c(Br)c1)c1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C18H8Br2Cl2N2OS/c19-13-4-9(5-14(20)17(13)25)3-10(7-23)18-24-16(8-26-18)12-2-1-11(21)6-15(12)22/h1-6,8,25H/b10-3- |
| InChIKey | ULXJHBQVTWSSHC-KMKOMSMNSA-N |
| XLogP | 7.41 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|