C18H9Cl2N3O2S — CID 5335424
(E)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(2-nitrophenyl)prop-2-enenitrile (PubChem CID 5335424) has the molecular formula C18H9Cl2N3O2S and a molecular weight of 402.26 g/mol. Its IUPAC name is (E)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(2-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(2-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5335424 |
| Molecular Formula | C18H9Cl2N3O2S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | (E)-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(2-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccccc1[N+](=O)[O-])c1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C18H9Cl2N3O2S/c19-13-5-6-14(15(20)8-13)16-10-26-18(22-16)12(9-21)7-11-3-1-2-4-17(11)23(24)25/h1-8,10H/b12-7+ |
| InChIKey | FQBYCGKUTDXJOJ-KPKJPENVSA-N |
| XLogP | 6.09 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|