C21H9Cl2N3O4S — CID 4197795
2-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(2-nitrophenyl)prop-2-enenitrile (PubChem CID 4197795) has the molecular formula C21H9Cl2N3O4S and a molecular weight of 470.29 g/mol. Its IUPAC name is 2-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(2-nitrophenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(2-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4197795 |
| Molecular Formula | C21H9Cl2N3O4S |
| Molecular Weight | 470.29 g/mol |
| Exact Mass | 468.97 |
| IUPAC Name | 2-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(2-nitrophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccccc1[N+](=O)[O-])c1nc(-c2cc3cc(Cl)cc(Cl)c3oc2=O)cs1 |
| InChI | InChI=1S/C21H9Cl2N3O4S/c22-14-6-12-7-15(21(27)30-19(12)16(23)8-14)17-10-31-20(25-17)13(9-24)5-11-3-1-2-4-18(11)26(28)29/h1-8,10H |
| InChIKey | RGIILDDGSCUDOX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 110.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.29 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|