C21H10Cl2N2O3S — CID 135426253
(E)-2-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(4-hydroxyphenyl)prop-2-enenitrile (PubChem CID 135426253) has the molecular formula C21H10Cl2N2O3S and a molecular weight of 441.30 g/mol. Its IUPAC name is (E)-2-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(4-hydroxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(4-hydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135426253 |
| Molecular Formula | C21H10Cl2N2O3S |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | (E)-2-[4-(6,8-dichloro-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(4-hydroxyphenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(O)cc1)c1nc(-c2cc3cc(Cl)cc(Cl)c3oc2=O)cs1 |
| InChI | InChI=1S/C21H10Cl2N2O3S/c22-14-6-12-7-16(21(27)28-19(12)17(23)8-14)18-10-29-20(25-18)13(9-24)5-11-1-3-15(26)4-2-11/h1-8,10,26H/b13-5+ |
| InChIKey | YWDGZJALNFKHBC-WLRTZDKTSA-N |
| XLogP | 5.99 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|