C25H14N2O2S — CID 3592854
2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]-3-phenylprop-2-enenitrile (PubChem CID 3592854) has the molecular formula C25H14N2O2S and a molecular weight of 406.47 g/mol. Its IUPAC name is 2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]-3-phenylprop-2-enenitrile.
| Compound Name | 2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 3592854 |
| Molecular Formula | C25H14N2O2S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]-3-phenylprop-2-enenitrile |
| SMILES | N#CC(=Cc1ccccc1)c1nc(-c2cc3c(ccc4ccccc43)oc2=O)cs1 |
| InChI | InChI=1S/C25H14N2O2S/c26-14-18(12-16-6-2-1-3-7-16)24-27-22(15-30-24)21-13-20-19-9-5-4-8-17(19)10-11-23(20)29-25(21)28/h1-13,15H |
| InChIKey | DZWQIKKIPWHTMK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|