C29H14ClN3O5S — CID 6196965
(E)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 6196965) has the molecular formula C29H14ClN3O5S and a molecular weight of 551.97 g/mol. Its IUPAC name is (E)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6196965 |
| Molecular Formula | C29H14ClN3O5S |
| Molecular Weight | 551.97 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | (E)-3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-[4-(3-oxobenzo[f]chromen-2-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1)c1nc(-c2cc3c(ccc4ccccc43)oc2=O)cs1 |
| InChI | InChI=1S/C29H14ClN3O5S/c30-24-12-18(33(35)36)6-8-21(24)26-10-7-19(37-26)11-17(14-31)28-32-25(15-39-28)23-13-22-20-4-2-1-3-16(20)5-9-27(22)38-29(23)34/h1-13,15H/b17-11+ |
| InChIKey | NNGJETMRGBHNSJ-GZTJUZNOSA-N |
| XLogP | 7.96 |
| TPSA | 123.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.97 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|