C27H16N2O3S — CID 3120938
2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile (PubChem CID 3120938) has the molecular formula C27H16N2O3S and a molecular weight of 448.50 g/mol. Its IUPAC name is 2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3120938 |
| Molecular Formula | C27H16N2O3S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cccc(Oc2ccccc2)c1)c1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C27H16N2O3S/c28-16-20(13-18-7-6-11-22(14-18)31-21-9-2-1-3-10-21)26-29-24(17-33-26)23-15-19-8-4-5-12-25(19)32-27(23)30/h1-15,17H |
| InChIKey | JKEVWUXYOADCIS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|