C22H16Cl2N2O4S — CID 6065066
[4-[(E)-2-cyano-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethenyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 6065066) has the molecular formula C22H16Cl2N2O4S and a molecular weight of 475.35 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethenyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[(E)-2-cyano-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethenyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 6065066 |
| Molecular Formula | C22H16Cl2N2O4S |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | [4-[(E)-2-cyano-2-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]ethenyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(/C=C(\C#N)c2nc(-c3ccc(Cl)cc3Cl)cs2)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C22H16Cl2N2O4S/c1-12(27)30-21-19(28-2)7-13(8-20(21)29-3)6-14(10-25)22-26-18(11-31-22)16-5-4-15(23)9-17(16)24/h4-9,11H,1-3H3/b14-6+ |
| InChIKey | PMCPLXZTYKHMIQ-MKMNVTDBSA-N |
| XLogP | 6.12 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|