C22H19ClN2O2S — CID 110531810
(Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enenitrile (PubChem CID 110531810) has the molecular formula C22H19ClN2O2S and a molecular weight of 410.93 g/mol. Its IUPAC name is (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110531810 |
| Molecular Formula | C22H19ClN2O2S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enenitrile |
| SMILES | CCCOc1ccc(/C=C(/C#N)c2nc(-c3ccc(Cl)cc3)cs2)cc1OC |
| InChI | InChI=1S/C22H19ClN2O2S/c1-3-10-27-20-9-4-15(12-21(20)26-2)11-17(13-24)22-25-19(14-28-22)16-5-7-18(23)8-6-16/h4-9,11-12,14H,3,10H2,1-2H3/b17-11- |
| InChIKey | HHCLDZYHMDKFLR-BOPFTXTBSA-N |
| XLogP | 6.33 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|