C27H22N2O2S — CID 6172603
(E)-3-(3-methoxy-4-phenylmethoxyphenyl)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 6172603) has the molecular formula C27H22N2O2S and a molecular weight of 438.55 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-phenylmethoxyphenyl)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(3-methoxy-4-phenylmethoxyphenyl)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6172603 |
| Molecular Formula | C27H22N2O2S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (E)-3-(3-methoxy-4-phenylmethoxyphenyl)-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)c2nc(-c3ccc(C)cc3)cs2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H22N2O2S/c1-19-8-11-22(12-9-19)24-18-32-27(29-24)23(16-28)14-21-10-13-25(26(15-21)30-2)31-17-20-6-4-3-5-7-20/h3-15,18H,17H2,1-2H3/b23-14+ |
| InChIKey | QXBVSMUHKLUIHJ-OEAKJJBVSA-N |
| XLogP | 6.77 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|