C26H25N3O4S — CID 4259260
3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 4259260) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is 3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4259260 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 3-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2nc(-c3ccc(C)cc3)cs2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H25N3O4S/c1-18-3-6-20(7-4-18)22-17-34-26(28-22)21(15-27)13-19-5-8-23(24(14-19)31-2)33-16-25(30)29-9-11-32-12-10-29/h3-8,13-14,17H,9-12,16H2,1-2H3 |
| InChIKey | HKPLXDYDXATAQD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 84.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|