C22H16N2O5S — CID 3472207
[4-[2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenyl] acetate (PubChem CID 3472207) has the molecular formula C22H16N2O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is [4-[2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 3472207 |
| Molecular Formula | C22H16N2O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | [4-[2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-cyanoethenyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C=C(C#N)c2nc(-c3ccc4c(c3)OCO4)cs2)ccc1OC(C)=O |
| InChI | InChI=1S/C22H16N2O5S/c1-13(25)29-19-5-3-14(8-20(19)26-2)7-16(10-23)22-24-17(11-30-22)15-4-6-18-21(9-15)28-12-27-18/h3-9,11H,12H2,1-2H3 |
| InChIKey | RDTPODSLTSHQKY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 90.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|