C19H11ClN2O2S — CID 7114906
(Z)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(3-chlorophenyl)prop-2-enenitrile (PubChem CID 7114906) has the molecular formula C19H11ClN2O2S and a molecular weight of 366.83 g/mol. Its IUPAC name is (Z)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(3-chlorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(3-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 7114906 |
| Molecular Formula | C19H11ClN2O2S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | (Z)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(3-chlorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cccc(Cl)c1)c1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C19H11ClN2O2S/c20-15-3-1-2-12(7-15)6-14(9-21)19-22-16(10-25-19)13-4-5-17-18(8-13)24-11-23-17/h1-8,10H,11H2/b14-6- |
| InChIKey | BXXDRTHAMWUQCI-NSIKDUERSA-N |
| XLogP | 5.26 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|