C21H14N2O2S — CID 1352095
(2Z,4E)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile (PubChem CID 1352095) has the molecular formula C21H14N2O2S and a molecular weight of 358.42 g/mol. Its IUPAC name is (2Z,4E)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 1352095 |
| Molecular Formula | C21H14N2O2S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (2Z,4E)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile |
| SMILES | N#C/C(=C/C=C/c1ccccc1)c1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C21H14N2O2S/c22-12-17(8-4-7-15-5-2-1-3-6-15)21-23-18(13-26-21)16-9-10-19-20(11-16)25-14-24-19/h1-11,13H,14H2/b7-4+,17-8- |
| InChIKey | RBGVCWQFQTWQLO-GUSDSWBTSA-N |
| XLogP | 5.16 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|