C19H11BrN2O2S — CID 46807531
(E)-3-(7-bromo-1,3-benzodioxol-5-yl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 46807531) has the molecular formula C19H11BrN2O2S and a molecular weight of 411.28 g/mol. Its IUPAC name is (E)-3-(7-bromo-1,3-benzodioxol-5-yl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(7-bromo-1,3-benzodioxol-5-yl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 46807531 |
| Molecular Formula | C19H11BrN2O2S |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | (E)-3-(7-bromo-1,3-benzodioxol-5-yl)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Br)c2c(c1)OCO2)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H11BrN2O2S/c20-15-7-12(8-17-18(15)24-11-23-17)6-14(9-21)19-22-16(10-25-19)13-4-2-1-3-5-13/h1-8,10H,11H2/b14-6+ |
| InChIKey | JZCXZRJNHCJGHF-MKMNVTDBSA-N |
| XLogP | 5.37 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|