C19H12ClN3O2S — CID 171977361
(Z)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(4-chloroanilino)prop-2-enenitrile (PubChem CID 171977361) has the molecular formula C19H12ClN3O2S and a molecular weight of 381.84 g/mol. Its IUPAC name is (Z)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(4-chloroanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(4-chloroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 171977361 |
| Molecular Formula | C19H12ClN3O2S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (Z)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(4-chloroanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1ccc(Cl)cc1)c1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C19H12ClN3O2S/c20-14-2-4-15(5-3-14)22-9-13(8-21)19-23-16(10-26-19)12-1-6-17-18(7-12)25-11-24-17/h1-7,9-10,22H,11H2/b13-9- |
| InChIKey | AJVWPZKXLHIGDZ-LCYFTJDESA-N |
| XLogP | 5.17 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|