C23H15N3O2S — CID 1352322
(E)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(naphthalen-2-ylamino)prop-2-enenitrile (PubChem CID 1352322) has the molecular formula C23H15N3O2S and a molecular weight of 397.46 g/mol. Its IUPAC name is (E)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(naphthalen-2-ylamino)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(naphthalen-2-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 1352322 |
| Molecular Formula | C23H15N3O2S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (E)-2-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(naphthalen-2-ylamino)prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ccc2ccccc2c1)c1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C23H15N3O2S/c24-11-18(12-25-19-7-5-15-3-1-2-4-16(15)9-19)23-26-20(13-29-23)17-6-8-21-22(10-17)28-14-27-21/h1-10,12-13,25H,14H2/b18-12+ |
| InChIKey | TWIZBYYZHIECNT-LDADJPATSA-N |
| XLogP | 5.67 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|