C26H19BrN2O2S — CID 3318126
2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile (PubChem CID 3318126) has the molecular formula C26H19BrN2O2S and a molecular weight of 503.42 g/mol. Its IUPAC name is 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3318126 |
| Molecular Formula | C26H19BrN2O2S |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2nc(-c3cccc(Br)c3)cs2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H19BrN2O2S/c1-30-25-13-19(10-11-24(25)31-16-18-6-3-2-4-7-18)12-21(15-28)26-29-23(17-32-26)20-8-5-9-22(27)14-20/h2-14,17H,16H2,1H3 |
| InChIKey | ZLEFRZDQJSDCSH-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|