C33H26N2O3S — CID 3805983
3-[3,4-bis(phenylmethoxy)phenyl]-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3805983) has the molecular formula C33H26N2O3S and a molecular weight of 530.65 g/mol. Its IUPAC name is 3-[3,4-bis(phenylmethoxy)phenyl]-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[3,4-bis(phenylmethoxy)phenyl]-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3805983 |
| Molecular Formula | C33H26N2O3S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 3-[3,4-bis(phenylmethoxy)phenyl]-2-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1cccc(-c2csc(C(C#N)=Cc3ccc(OCc4ccccc4)c(OCc4ccccc4)c3)n2)c1 |
| InChI | InChI=1S/C33H26N2O3S/c1-36-29-14-8-13-27(19-29)30-23-39-33(35-30)28(20-34)17-26-15-16-31(37-21-24-9-4-2-5-10-24)32(18-26)38-22-25-11-6-3-7-12-25/h2-19,23H,21-22H2,1H3 |
| InChIKey | HHYJBGJZTJBILD-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|