C21H17ClN2O3S — CID 110531656
(Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 110531656) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110531656 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | (Z)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-(2,4,5-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(/C#N)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C21H17ClN2O3S/c1-25-18-10-20(27-3)19(26-2)9-14(18)8-15(11-23)21-24-17(12-28-21)13-4-6-16(22)7-5-13/h4-10,12H,1-3H3/b15-8- |
| InChIKey | DGLPMKABMGNWHL-NVNXTCNLSA-N |
| XLogP | 5.55 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|