C21H11Cl2N3O2S — CID 1358410
3-(2,5-dichloroanilino)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 1358410) has the molecular formula C21H11Cl2N3O2S and a molecular weight of 440.31 g/mol. Its IUPAC name is 3-(2,5-dichloroanilino)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(2,5-dichloroanilino)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 1358410 |
| Molecular Formula | C21H11Cl2N3O2S |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 3-(2,5-dichloroanilino)-2-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(Cl)ccc1Cl)c1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C21H11Cl2N3O2S/c22-14-5-6-16(23)17(8-14)25-10-13(9-24)20-26-18(11-29-20)15-7-12-3-1-2-4-19(12)28-21(15)27/h1-8,10-11,25H |
| InChIKey | VVHLIQAYNOPEHE-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|